C13H16ClN5O — CID 82202007
2-[4-(aminomethyl)-5-methyltriazol-1-yl]-N-(4-chlorophenyl)propanamide (PubChem CID 82202007) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-5-methyltriazol-1-yl]-N-(4-chlorophenyl)propanamide.
| Compound Name | 2-[4-(aminomethyl)-5-methyltriazol-1-yl]-N-(4-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 82202007 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-[4-(aminomethyl)-5-methyltriazol-1-yl]-N-(4-chlorophenyl)propanamide |
| SMILES | Cc1c(CN)nnn1C(C)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClN5O/c1-8-12(7-15)17-18-19(8)9(2)13(20)16-11-5-3-10(14)4-6-11/h3-6,9H,7,15H2,1-2H3,(H,16,20) |
| InChIKey | OIZUORYIIHLVEM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |