C13H13ClN4O2 — CID 82202006
N-(4-chlorophenyl)-2-(4-formyl-5-methyltriazol-1-yl)propanamide (PubChem CID 82202006) has the molecular formula C13H13ClN4O2 and a molecular weight of 292.73 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(4-formyl-5-methyltriazol-1-yl)propanamide.
| Compound Name | N-(4-chlorophenyl)-2-(4-formyl-5-methyltriazol-1-yl)propanamide |
|---|---|
| PubChem CID | 82202006 |
| Molecular Formula | C13H13ClN4O2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-(4-chlorophenyl)-2-(4-formyl-5-methyltriazol-1-yl)propanamide |
| SMILES | Cc1c(C=O)nnn1C(C)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClN4O2/c1-8-12(7-19)16-17-18(8)9(2)13(20)15-11-5-3-10(14)4-6-11/h3-7,9H,1-2H3,(H,15,20) |
| InChIKey | PNZGKNXNLPIQBI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|