C14H22N4O3 — CID 82202464
1-[2-[butyl(methyl)amino]-2-oxoethyl]-5-cyclobutyltriazole-4-carboxylic acid (PubChem CID 82202464) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-[2-[butyl(methyl)amino]-2-oxoethyl]-5-cyclobutyltriazole-4-carboxylic acid.
| Compound Name | 1-[2-[butyl(methyl)amino]-2-oxoethyl]-5-cyclobutyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82202464 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-[2-[butyl(methyl)amino]-2-oxoethyl]-5-cyclobutyltriazole-4-carboxylic acid |
| SMILES | CCCCN(C)C(=O)Cn1nnc(C(=O)O)c1C1CCC1 |
| InChI | InChI=1S/C14H22N4O3/c1-3-4-8-17(2)11(19)9-18-13(10-6-5-7-10)12(14(20)21)15-16-18/h10H,3-9H2,1-2H3,(H,20,21) |
| InChIKey | IOELUWCTEOWADY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |