C10H13N3O2 — CID 82210566
5-cyclopropyl-1-(2-methylprop-2-enyl)triazole-4-carboxylic acid (PubChem CID 82210566) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 5-cyclopropyl-1-(2-methylprop-2-enyl)triazole-4-carboxylic acid.
| Compound Name | 5-cyclopropyl-1-(2-methylprop-2-enyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82210566 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 5-cyclopropyl-1-(2-methylprop-2-enyl)triazole-4-carboxylic acid |
| SMILES | C=C(C)Cn1nnc(C(=O)O)c1C1CC1 |
| InChI | InChI=1S/C10H13N3O2/c1-6(2)5-13-9(7-3-4-7)8(10(14)15)11-12-13/h7H,1,3-5H2,2H3,(H,14,15) |
| InChIKey | PVDINECYUXYHIL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|