C10H15N3O5 — CID 82202521
1-[2-oxo-2-(2-propoxyethoxy)ethyl]triazole-4-carboxylic acid (PubChem CID 82202521) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is 1-[2-oxo-2-(2-propoxyethoxy)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-oxo-2-(2-propoxyethoxy)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82202521 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-[2-oxo-2-(2-propoxyethoxy)ethyl]triazole-4-carboxylic acid |
| SMILES | CCCOCCOC(=O)Cn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C10H15N3O5/c1-2-3-17-4-5-18-9(14)7-13-6-8(10(15)16)11-12-13/h6H,2-5,7H2,1H3,(H,15,16) |
| InChIKey | HGBCCKIFLFWAOG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|