C13H15ClN4 — CID 82203359
[1-[(4-chlorophenyl)methyl]-5-cyclopropyltriazol-4-yl]methanamine (PubChem CID 82203359) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]-5-cyclopropyltriazol-4-yl]methanamine.
| Compound Name | [1-[(4-chlorophenyl)methyl]-5-cyclopropyltriazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82203359 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]-5-cyclopropyltriazol-4-yl]methanamine |
| SMILES | NCc1nnn(Cc2ccc(Cl)cc2)c1C1CC1 |
| InChI | InChI=1S/C13H15ClN4/c14-11-5-1-9(2-6-11)8-18-13(10-3-4-10)12(7-15)16-17-18/h1-2,5-6,10H,3-4,7-8,15H2 |
| InChIKey | ZPSRRDBOICDWGO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |