C16H21FN4 — CID 82211827
[5-cyclohexyl-1-[(3-fluorophenyl)methyl]triazol-4-yl]methanamine (PubChem CID 82211827) has the molecular formula C16H21FN4 and a molecular weight of 288.37 g/mol. Its IUPAC name is [5-cyclohexyl-1-[(3-fluorophenyl)methyl]triazol-4-yl]methanamine.
| Compound Name | [5-cyclohexyl-1-[(3-fluorophenyl)methyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82211827 |
| Molecular Formula | C16H21FN4 |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | [5-cyclohexyl-1-[(3-fluorophenyl)methyl]triazol-4-yl]methanamine |
| SMILES | NCc1nnn(Cc2cccc(F)c2)c1C1CCCCC1 |
| InChI | InChI=1S/C16H21FN4/c17-14-8-4-5-12(9-14)11-21-16(15(10-18)19-20-21)13-6-2-1-3-7-13/h4-5,8-9,13H,1-3,6-7,10-11,18H2 |
| InChIKey | ARDOKXASYDWWKR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |