C15H14FN5 — CID 82211840
[1-[(3-fluorophenyl)methyl]-5-pyridin-3-yltriazol-4-yl]methanamine (PubChem CID 82211840) has the molecular formula C15H14FN5 and a molecular weight of 283.31 g/mol. Its IUPAC name is [1-[(3-fluorophenyl)methyl]-5-pyridin-3-yltriazol-4-yl]methanamine.
| Compound Name | [1-[(3-fluorophenyl)methyl]-5-pyridin-3-yltriazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82211840 |
| Molecular Formula | C15H14FN5 |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | [1-[(3-fluorophenyl)methyl]-5-pyridin-3-yltriazol-4-yl]methanamine |
| SMILES | NCc1nnn(Cc2cccc(F)c2)c1-c1cccnc1 |
| InChI | InChI=1S/C15H14FN5/c16-13-5-1-3-11(7-13)10-21-15(14(8-17)19-20-21)12-4-2-6-18-9-12/h1-7,9H,8,10,17H2 |
| InChIKey | ZDQFHJXKTQZUJP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |