C16H21N3O3 — CID 82205255
1-butyl-5-[(2,6-dimethylphenoxy)methyl]triazole-4-carboxylic acid (PubChem CID 82205255) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-butyl-5-[(2,6-dimethylphenoxy)methyl]triazole-4-carboxylic acid.
| Compound Name | 1-butyl-5-[(2,6-dimethylphenoxy)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82205255 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-butyl-5-[(2,6-dimethylphenoxy)methyl]triazole-4-carboxylic acid |
| SMILES | CCCCn1nnc(C(=O)O)c1COc1c(C)cccc1C |
| InChI | InChI=1S/C16H21N3O3/c1-4-5-9-19-13(14(16(20)21)17-18-19)10-22-15-11(2)7-6-8-12(15)3/h6-8H,4-5,9-10H2,1-3H3,(H,20,21) |
| InChIKey | BKURHRLSFBWNPG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |