C5H8N4O — CID 82207950
1,5-dimethyltriazole-4-carboxamide (PubChem CID 82207950) has the molecular formula C5H8N4O and a molecular weight of 140.15 g/mol. Its IUPAC name is 1,5-dimethyltriazole-4-carboxamide.
| Compound Name | 1,5-dimethyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 82207950 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 1,5-dimethyltriazole-4-carboxamide |
| SMILES | Cc1c(C(N)=O)nnn1C |
| InChI | InChI=1S/C5H8N4O/c1-3-4(5(6)10)7-8-9(3)2/h1-2H3,(H2,6,10) |
| InChIKey | PJXSDUAVGOUPTJ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |