C16H20N4O2 — CID 82208348
5-[(3-methoxyphenoxy)methyl]-1-(3-methylbutyl)triazole-4-carbonitrile (PubChem CID 82208348) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 5-[(3-methoxyphenoxy)methyl]-1-(3-methylbutyl)triazole-4-carbonitrile.
| Compound Name | 5-[(3-methoxyphenoxy)methyl]-1-(3-methylbutyl)triazole-4-carbonitrile |
|---|---|
| PubChem CID | 82208348 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 5-[(3-methoxyphenoxy)methyl]-1-(3-methylbutyl)triazole-4-carbonitrile |
| SMILES | COc1cccc(OCc2c(C#N)nnn2CCC(C)C)c1 |
| InChI | InChI=1S/C16H20N4O2/c1-12(2)7-8-20-16(15(10-17)18-19-20)11-22-14-6-4-5-13(9-14)21-3/h4-6,9,12H,7-8,11H2,1-3H3 |
| InChIKey | PEGYBQJWGAKVIV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |