C17H22N4O — CID 82205776
5-[(2,3-dimethylphenoxy)methyl]-1-pentyltriazole-4-carbonitrile (PubChem CID 82205776) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 5-[(2,3-dimethylphenoxy)methyl]-1-pentyltriazole-4-carbonitrile.
| Compound Name | 5-[(2,3-dimethylphenoxy)methyl]-1-pentyltriazole-4-carbonitrile |
|---|---|
| PubChem CID | 82205776 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 5-[(2,3-dimethylphenoxy)methyl]-1-pentyltriazole-4-carbonitrile |
| SMILES | CCCCCn1nnc(C#N)c1COc1cccc(C)c1C |
| InChI | InChI=1S/C17H22N4O/c1-4-5-6-10-21-16(15(11-18)19-20-21)12-22-17-9-7-8-13(2)14(17)3/h7-9H,4-6,10,12H2,1-3H3 |
| InChIKey | FPUCJSDNOPWSOS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|