C14H21N5O — CID 84759019
4-[5-[(2,3-dimethylphenoxy)methyl]tetrazol-1-yl]butan-1-amine (PubChem CID 84759019) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-[5-[(2,3-dimethylphenoxy)methyl]tetrazol-1-yl]butan-1-amine.
| Compound Name | 4-[5-[(2,3-dimethylphenoxy)methyl]tetrazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 84759019 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4-[5-[(2,3-dimethylphenoxy)methyl]tetrazol-1-yl]butan-1-amine |
| SMILES | Cc1cccc(OCc2nnnn2CCCCN)c1C |
| InChI | InChI=1S/C14H21N5O/c1-11-6-5-7-13(12(11)2)20-10-14-16-17-18-19(14)9-4-3-8-15/h5-7H,3-4,8-10,15H2,1-2H3 |
| InChIKey | QWCKFYYAXAQMIQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|