C8H16N4 — CID 82208466
[3-(3-methylbutyl)triazol-4-yl]methanamine (PubChem CID 82208466) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is [3-(3-methylbutyl)triazol-4-yl]methanamine.
| Compound Name | [3-(3-methylbutyl)triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82208466 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | [3-(3-methylbutyl)triazol-4-yl]methanamine |
| SMILES | CC(C)CCn1nncc1CN |
| InChI | InChI=1S/C8H16N4/c1-7(2)3-4-12-8(5-9)6-10-11-12/h6-7H,3-5,9H2,1-2H3 |
| InChIKey | KRWYMIPOLMNRAZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |