C13H15FN4O2 — CID 82211268
2-[5-[(4-fluorophenyl)methyl]-4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide (PubChem CID 82211268) has the molecular formula C13H15FN4O2 and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-[5-[(4-fluorophenyl)methyl]-4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide.
| Compound Name | 2-[5-[(4-fluorophenyl)methyl]-4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 82211268 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[5-[(4-fluorophenyl)methyl]-4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cn1nnc(CO)c1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN4O2/c1-15-13(20)7-18-12(11(8-19)16-17-18)6-9-2-4-10(14)5-3-9/h2-5,19H,6-8H2,1H3,(H,15,20) |
| InChIKey | YCRKCUQTNSASGG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |