C13H15ClN4O3 — CID 94946248
2-[5-[(4-chlorophenoxy)methyl]-4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide (PubChem CID 94946248) has the molecular formula C13H15ClN4O3 and a molecular weight of 310.74 g/mol. Its IUPAC name is 2-[5-[(4-chlorophenoxy)methyl]-4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide.
| Compound Name | 2-[5-[(4-chlorophenoxy)methyl]-4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 94946248 |
| Molecular Formula | C13H15ClN4O3 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-[5-[(4-chlorophenoxy)methyl]-4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cn1nnc(CO)c1COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H15ClN4O3/c1-15-13(20)6-18-12(11(7-19)16-17-18)8-21-10-4-2-9(14)3-5-10/h2-5,19H,6-8H2,1H3,(H,15,20) |
| InChIKey | HSKACBWXWKIXIR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |