C16H23N3O3 — CID 82208710
[5-[(4-ethoxyphenoxy)methyl]-1-(2-methylpropyl)triazol-4-yl]methanol (PubChem CID 82208710) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is [5-[(4-ethoxyphenoxy)methyl]-1-(2-methylpropyl)triazol-4-yl]methanol.
| Compound Name | [5-[(4-ethoxyphenoxy)methyl]-1-(2-methylpropyl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 82208710 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | [5-[(4-ethoxyphenoxy)methyl]-1-(2-methylpropyl)triazol-4-yl]methanol |
| SMILES | CCOc1ccc(OCc2c(CO)nnn2CC(C)C)cc1 |
| InChI | InChI=1S/C16H23N3O3/c1-4-21-13-5-7-14(8-6-13)22-11-16-15(10-20)17-18-19(16)9-12(2)3/h5-8,12,20H,4,9-11H2,1-3H3 |
| InChIKey | FQHHKEOJBLCVJC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |