C15H21N3O4 — CID 94946321
3-[5-[(4-ethoxyphenoxy)methyl]-4-(hydroxymethyl)triazol-1-yl]propan-1-ol (PubChem CID 94946321) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[5-[(4-ethoxyphenoxy)methyl]-4-(hydroxymethyl)triazol-1-yl]propan-1-ol.
| Compound Name | 3-[5-[(4-ethoxyphenoxy)methyl]-4-(hydroxymethyl)triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 94946321 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-[5-[(4-ethoxyphenoxy)methyl]-4-(hydroxymethyl)triazol-1-yl]propan-1-ol |
| SMILES | CCOc1ccc(OCc2c(CO)nnn2CCCO)cc1 |
| InChI | InChI=1S/C15H21N3O4/c1-2-21-12-4-6-13(7-5-12)22-11-15-14(10-20)16-17-18(15)8-3-9-19/h4-7,19-20H,2-3,8-11H2,1H3 |
| InChIKey | RHBOAKWXWVQZOV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |