C18H15ClN2O2 — CID 82212267
2-(4-chlorophenyl)-1-(2,4-dimethylphenyl)imidazole-4-carboxylic acid (PubChem CID 82212267) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(2,4-dimethylphenyl)imidazole-4-carboxylic acid.
| Compound Name | 2-(4-chlorophenyl)-1-(2,4-dimethylphenyl)imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82212267 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(2,4-dimethylphenyl)imidazole-4-carboxylic acid |
| SMILES | Cc1ccc(-n2cc(C(=O)O)nc2-c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C18H15ClN2O2/c1-11-3-8-16(12(2)9-11)21-10-15(18(22)23)20-17(21)13-4-6-14(19)7-5-13/h3-10H,1-2H3,(H,22,23) |
| InChIKey | RINSACLFQJRVJB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |