C10H7FN2O2S2 — CID 82213848
7-fluoro-3-prop-2-ynylsulfanyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 82213848) has the molecular formula C10H7FN2O2S2 and a molecular weight of 270.31 g/mol. Its IUPAC name is 7-fluoro-3-prop-2-ynylsulfanyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 7-fluoro-3-prop-2-ynylsulfanyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 82213848 |
| Molecular Formula | C10H7FN2O2S2 |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 7-fluoro-3-prop-2-ynylsulfanyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | C#CCSC1=NS(=O)(=O)c2cc(F)ccc2N1 |
| InChI | InChI=1S/C10H7FN2O2S2/c1-2-5-16-10-12-8-4-3-7(11)6-9(8)17(14,15)13-10/h1,3-4,6H,5H2,(H,12,13) |
| InChIKey | JODMPAZWJAANMR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|