C18H28ClN — CID 82214703
1-[2-(4-tert-butylphenyl)-2-chloroethyl]-2-methylpiperidine (PubChem CID 82214703) has the molecular formula C18H28ClN and a molecular weight of 293.88 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)-2-chloroethyl]-2-methylpiperidine.
| Compound Name | 1-[2-(4-tert-butylphenyl)-2-chloroethyl]-2-methylpiperidine |
|---|---|
| PubChem CID | 82214703 |
| Molecular Formula | C18H28ClN |
| Molecular Weight | 293.88 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)-2-chloroethyl]-2-methylpiperidine |
| SMILES | CC1CCCCN1CC(Cl)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28ClN/c1-14-7-5-6-12-20(14)13-17(19)15-8-10-16(11-9-15)18(2,3)4/h8-11,14,17H,5-7,12-13H2,1-4H3 |
| InChIKey | SDSYEZBICIQGJX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.88 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|