C14H18ClF2N — CID 82215703
1-[2-chloro-2-(3,4-difluorophenyl)ethyl]-2-methylpiperidine (PubChem CID 82215703) has the molecular formula C14H18ClF2N and a molecular weight of 273.75 g/mol. Its IUPAC name is 1-[2-chloro-2-(3,4-difluorophenyl)ethyl]-2-methylpiperidine.
| Compound Name | 1-[2-chloro-2-(3,4-difluorophenyl)ethyl]-2-methylpiperidine |
|---|---|
| PubChem CID | 82215703 |
| Molecular Formula | C14H18ClF2N |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-[2-chloro-2-(3,4-difluorophenyl)ethyl]-2-methylpiperidine |
| SMILES | CC1CCCCN1CC(Cl)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H18ClF2N/c1-10-4-2-3-7-18(10)9-12(15)11-5-6-13(16)14(17)8-11/h5-6,8,10,12H,2-4,7,9H2,1H3 |
| InChIKey | ISZQVLODRUMEBB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|