C18H22ClNO — CID 82215347
4-[[2-chloro-2-(2,4,6-trimethylphenyl)ethyl]-methylamino]phenol (PubChem CID 82215347) has the molecular formula C18H22ClNO and a molecular weight of 303.83 g/mol. Its IUPAC name is 4-[[2-chloro-2-(2,4,6-trimethylphenyl)ethyl]-methylamino]phenol.
| Compound Name | 4-[[2-chloro-2-(2,4,6-trimethylphenyl)ethyl]-methylamino]phenol |
|---|---|
| PubChem CID | 82215347 |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[[2-chloro-2-(2,4,6-trimethylphenyl)ethyl]-methylamino]phenol |
| SMILES | Cc1cc(C)c(C(Cl)CN(C)c2ccc(O)cc2)c(C)c1 |
| InChI | InChI=1S/C18H22ClNO/c1-12-9-13(2)18(14(3)10-12)17(19)11-20(4)15-5-7-16(21)8-6-15/h5-10,17,21H,11H2,1-4H3 |
| InChIKey | XEBIEBMZYGIIHF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|