C17H20FNO3 — CID 70839034
1-fluoro-4-[4-(4-hydroxyphenyl)-N-methylanilino]butane-2,3-diol (PubChem CID 70839034) has the molecular formula C17H20FNO3 and a molecular weight of 305.35 g/mol. Its IUPAC name is 1-fluoro-4-[4-(4-hydroxyphenyl)-N-methylanilino]butane-2,3-diol.
| Compound Name | 1-fluoro-4-[4-(4-hydroxyphenyl)-N-methylanilino]butane-2,3-diol |
|---|---|
| PubChem CID | 70839034 |
| Molecular Formula | C17H20FNO3 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-fluoro-4-[4-(4-hydroxyphenyl)-N-methylanilino]butane-2,3-diol |
| SMILES | CN(CC(O)C(O)CF)c1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C17H20FNO3/c1-19(11-17(22)16(21)10-18)14-6-2-12(3-7-14)13-4-8-15(20)9-5-13/h2-9,16-17,20-22H,10-11H2,1H3 |
| InChIKey | CVEHKKJOIHBRQO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |