C13H13N3O3S — CID 822154
3-methyl-2-[2-(4-nitrophenyl)ethylsulfanyl]pyrimidin-4-one (PubChem CID 822154) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 3-methyl-2-[2-(4-nitrophenyl)ethylsulfanyl]pyrimidin-4-one.
| Compound Name | 3-methyl-2-[2-(4-nitrophenyl)ethylsulfanyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 822154 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-methyl-2-[2-(4-nitrophenyl)ethylsulfanyl]pyrimidin-4-one |
| SMILES | Cn1c(SCCc2ccc([N+](=O)[O-])cc2)nccc1=O |
| InChI | InChI=1S/C13H13N3O3S/c1-15-12(17)6-8-14-13(15)20-9-7-10-2-4-11(5-3-10)16(18)19/h2-6,8H,7,9H2,1H3 |
| InChIKey | HKHXBZZOCGQHPB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|