C13H11N3O3S — CID 912302
(2Z)-2-[(4-nitrophenyl)methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one (PubChem CID 912302) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is (2Z)-2-[(4-nitrophenyl)methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one.
| Compound Name | (2Z)-2-[(4-nitrophenyl)methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
|---|---|
| PubChem CID | 912302 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | (2Z)-2-[(4-nitrophenyl)methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
| SMILES | O=c1/c(=C/c2ccc([N+](=O)[O-])cc2)sc2n1CCCN=2 |
| InChI | InChI=1S/C13H11N3O3S/c17-12-11(20-13-14-6-1-7-15(12)13)8-9-2-4-10(5-3-9)16(18)19/h2-5,8H,1,6-7H2/b11-8- |
| InChIKey | FRDAAVRIVNZSOL-FLIBITNWSA-N |
| XLogP | 0.67 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|