C15H26N2O4 — CID 82217360
2-[[bis(2-hydroxyethyl)amino]methyl]-1-butyl-3-hydroxy-6-methylpyridin-4-one (PubChem CID 82217360) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-[[bis(2-hydroxyethyl)amino]methyl]-1-butyl-3-hydroxy-6-methylpyridin-4-one.
| Compound Name | 2-[[bis(2-hydroxyethyl)amino]methyl]-1-butyl-3-hydroxy-6-methylpyridin-4-one |
|---|---|
| PubChem CID | 82217360 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[[bis(2-hydroxyethyl)amino]methyl]-1-butyl-3-hydroxy-6-methylpyridin-4-one |
| SMILES | CCCCn1c(C)cc(=O)c(O)c1CN(CCO)CCO |
| InChI | InChI=1S/C15H26N2O4/c1-3-4-5-17-12(2)10-14(20)15(21)13(17)11-16(6-8-18)7-9-19/h10,18-19,21H,3-9,11H2,1-2H3 |
| InChIKey | BILFDPLVDPWMPK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |