C16H29N3O2 — CID 82217692
1-[3-(diethylamino)propyl]-2-[(dimethylamino)methyl]-3-hydroxy-6-methylpyridin-4-one (PubChem CID 82217692) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-2-[(dimethylamino)methyl]-3-hydroxy-6-methylpyridin-4-one.
| Compound Name | 1-[3-(diethylamino)propyl]-2-[(dimethylamino)methyl]-3-hydroxy-6-methylpyridin-4-one |
|---|---|
| PubChem CID | 82217692 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-2-[(dimethylamino)methyl]-3-hydroxy-6-methylpyridin-4-one |
| SMILES | CCN(CC)CCCn1c(C)cc(=O)c(O)c1CN(C)C |
| InChI | InChI=1S/C16H29N3O2/c1-6-18(7-2)9-8-10-19-13(3)11-15(20)16(21)14(19)12-17(4)5/h11,21H,6-10,12H2,1-5H3 |
| InChIKey | MMCPPSKRVGYTKO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |