C15H24N2O4 — CID 82217822
2-[2-[(dimethylamino)methyl]-3-hydroxy-6-methyl-4-oxo-1-pyridinyl]-4-methylpentanoic acid (PubChem CID 82217822) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[2-[(dimethylamino)methyl]-3-hydroxy-6-methyl-4-oxo-1-pyridinyl]-4-methylpentanoic acid.
| Compound Name | 2-[2-[(dimethylamino)methyl]-3-hydroxy-6-methyl-4-oxo-1-pyridinyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82217822 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[2-[(dimethylamino)methyl]-3-hydroxy-6-methyl-4-oxo-1-pyridinyl]-4-methylpentanoic acid |
| SMILES | Cc1cc(=O)c(O)c(CN(C)C)n1C(CC(C)C)C(=O)O |
| InChI | InChI=1S/C15H24N2O4/c1-9(2)6-11(15(20)21)17-10(3)7-13(18)14(19)12(17)8-16(4)5/h7,9,11,19H,6,8H2,1-5H3,(H,20,21) |
| InChIKey | CULXLSYUOPUWPY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |