2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid

C10H15NO3 — CID 82219971

IUPAC2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid
SMILESCCCCc1nc(CC(=O)O)c(C)o1
InChIInChI=1S/C10H15NO3/c1-3-4-5-9-11-8(6-10(12)13)7(2)14-9/h3-6H2,1-2H3,(H,12,13)
InChIKeyPZJVXSSGQQWIKY-UHFFFAOYSA-N
MW197.23 g/mol
LogP1.95
Rot. Bonds5

About 2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid

2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid (PubChem CID 82219971) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid
PubChem CID82219971
Molecular FormulaC10H15NO3
Molecular Weight197.23 g/mol
Exact Mass197.11
IUPAC Name2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid
SMILESCCCCc1nc(CC(=O)O)c(C)o1
InChIInChI=1S/C10H15NO3/c1-3-4-5-9-11-8(6-10(12)13)7(2)14-9/h3-6H2,1-2H3,(H,12,13)
InChIKeyPZJVXSSGQQWIKY-UHFFFAOYSA-N
XLogP1.95
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.23
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid
CID 82219979
2-[2-(2-cyclohexylethyl)-5-methyl-1,3-oxazol-4-yl]acetic acid
CID 82219993
2-[2-[(2,3-dimethylphenoxy)methyl]-5-methyl-1,3-oxazol-4-yl]acetic acid
CID 82219984
5-methyl-2-propyl-1,3-oxazole-4-carboxylic acid
CID 62232826
methyl 2-butyl-4-(methoxymethyl)-1,3-oxazole-5-carboxylate
CID 114371711
2-(5-hexadecyl-2-methyl-1,3-thiazol-4-yl)acetic acid
CID 102100077
4-(aminomethyl)-2-propyl-1,3-oxazole-5-carboxylic acid
CID 115059898
2-(3-pentyl-1,2,4-oxadiazol-5-yl)acetic acid
CID 70237676
5-butyl-1,3,4-oxadiazole-2-carboxylic acid
CID 112619580
2-(3-phenylpropyl)-4-propyl-1,3-oxazole-5-carboxylic acid
CID 114373150
2-[2-(2-bromophenyl)-5-methyl-1,3-oxazol-4-yl]acetic acid
CID 82219974
2-butyl-1,3-benzoxazole-5-carboxylic acid
CID 2763366

Frequently Asked Questions

What is the IUPAC name of 2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid?
The IUPAC name of 2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid (CID 82219971) is 2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid.
What is the SMILES notation for 2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid?
The canonical SMILES for 2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid is CCCCc1nc(CC(=O)O)c(C)o1.
What is the InChIKey of 2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid?
The InChIKey is PZJVXSSGQQWIKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-3-4-5-9-11-8(6-10(12)13)7(2)14-9/h3-6H2,1-2H3,(H,12,13).
What are the key properties of 2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid?
2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid has a molecular weight of 197.23 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butyl-5-methyl-1,3-oxazol-4-yl)acetic acid is sourced from PubChem (CID 82219971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).