2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid

C15H17NO4 — CID 82219979

IUPAC2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid
SMILESCc1oc(CCCOc2ccccc2)nc1CC(=O)O
InChIInChI=1S/C15H17NO4/c1-11-13(10-15(17)18)16-14(20-11)8-5-9-19-12-6-3-2-4-7-12/h2-4,6-7H,5,8-10H2,1H3,(H,17,18)
InChIKeyJCKQTFSLDLQYTB-UHFFFAOYSA-N
MW275.30 g/mol
LogP2.62
Rot. Bonds7

About 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid

2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 82219979) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid
PubChem CID82219979
Molecular FormulaC15H17NO4
Molecular Weight275.30 g/mol
Exact Mass275.12
IUPAC Name2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid
SMILESCc1oc(CCCOc2ccccc2)nc1CC(=O)O
InChIInChI=1S/C15H17NO4/c1-11-13(10-15(17)18)16-14(20-11)8-5-9-19-12-6-3-2-4-7-12/h2-4,6-7H,5,8-10H2,1H3,(H,17,18)
InChIKeyJCKQTFSLDLQYTB-UHFFFAOYSA-N
XLogP2.62
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.30
LogP ≤ 52.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid?
The IUPAC name of 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid (CID 82219979) is 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid.
What is the SMILES notation for 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid?
The canonical SMILES for 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid is Cc1oc(CCCOc2ccccc2)nc1CC(=O)O.
What is the InChIKey of 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid?
The InChIKey is JCKQTFSLDLQYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO4/c1-11-13(10-15(17)18)16-14(20-11)8-5-9-19-12-6-3-2-4-7-12/h2-4,6-7H,5,8-10H2,1H3,(H,17,18).
What are the key properties of 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid?
2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid has a molecular weight of 275.30 g/mol, XLogP of 2.62, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid is sourced from PubChem (CID 82219979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).