C15H17NO4 — CID 82219979
2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 82219979) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid.
| Compound Name | 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 82219979 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[5-methyl-2-(3-phenoxypropyl)-1,3-oxazol-4-yl]acetic acid |
| SMILES | Cc1oc(CCCOc2ccccc2)nc1CC(=O)O |
| InChI | InChI=1S/C15H17NO4/c1-11-13(10-15(17)18)16-14(20-11)8-5-9-19-12-6-3-2-4-7-12/h2-4,6-7H,5,8-10H2,1H3,(H,17,18) |
| InChIKey | JCKQTFSLDLQYTB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|