C15H17NO3 — CID 158824596
1-(5-methyl-1,3-oxazol-2-yl)-5-phenoxypentan-2-one (PubChem CID 158824596) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-(5-methyl-1,3-oxazol-2-yl)-5-phenoxypentan-2-one.
| Compound Name | 1-(5-methyl-1,3-oxazol-2-yl)-5-phenoxypentan-2-one |
|---|---|
| PubChem CID | 158824596 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-(5-methyl-1,3-oxazol-2-yl)-5-phenoxypentan-2-one |
| SMILES | Cc1cnc(CC(=O)CCCOc2ccccc2)o1 |
| InChI | InChI=1S/C15H17NO3/c1-12-11-16-15(19-12)10-13(17)6-5-9-18-14-7-3-2-4-8-14/h2-4,7-8,11H,5-6,9-10H2,1H3 |
| InChIKey | IWHMAQGVFNTSMQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|