C14H14BrNO2S — CID 159309628
1-(5-bromo-1,3-thiazol-2-yl)-5-phenoxypentan-2-one (PubChem CID 159309628) has the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. Its IUPAC name is 1-(5-bromo-1,3-thiazol-2-yl)-5-phenoxypentan-2-one.
| Compound Name | 1-(5-bromo-1,3-thiazol-2-yl)-5-phenoxypentan-2-one |
|---|---|
| PubChem CID | 159309628 |
| Molecular Formula | C14H14BrNO2S |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 1-(5-bromo-1,3-thiazol-2-yl)-5-phenoxypentan-2-one |
| SMILES | O=C(CCCOc1ccccc1)Cc1ncc(Br)s1 |
| InChI | InChI=1S/C14H14BrNO2S/c15-13-10-16-14(19-13)9-11(17)5-4-8-18-12-6-2-1-3-7-12/h1-3,6-7,10H,4-5,8-9H2 |
| InChIKey | PUUCTBPEXDNLBJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|