C14H12BrCl2NO2S — CID 158522481
5-(4-bromo-3-chlorophenoxy)-1-(5-chloro-1,3-thiazol-2-yl)pentan-2-one (PubChem CID 158522481) has the molecular formula C14H12BrCl2NO2S and a molecular weight of 409.13 g/mol. Its IUPAC name is 5-(4-bromo-3-chlorophenoxy)-1-(5-chloro-1,3-thiazol-2-yl)pentan-2-one.
| Compound Name | 5-(4-bromo-3-chlorophenoxy)-1-(5-chloro-1,3-thiazol-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 158522481 |
| Molecular Formula | C14H12BrCl2NO2S |
| Molecular Weight | 409.13 g/mol |
| Exact Mass | 406.91 |
| IUPAC Name | 5-(4-bromo-3-chlorophenoxy)-1-(5-chloro-1,3-thiazol-2-yl)pentan-2-one |
| SMILES | O=C(CCCOc1ccc(Br)c(Cl)c1)Cc1ncc(Cl)s1 |
| InChI | InChI=1S/C14H12BrCl2NO2S/c15-11-4-3-10(7-12(11)16)20-5-1-2-9(19)6-14-18-8-13(17)21-14/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | HMJPNXAQAGWINP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.13 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|