C17H23NO2 — CID 141088768
5-methyl-2-pentan-3-yl-4-(2-phenoxyethyl)-1,3-oxazole (PubChem CID 141088768) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 5-methyl-2-pentan-3-yl-4-(2-phenoxyethyl)-1,3-oxazole.
| Compound Name | 5-methyl-2-pentan-3-yl-4-(2-phenoxyethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 141088768 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 5-methyl-2-pentan-3-yl-4-(2-phenoxyethyl)-1,3-oxazole |
| SMILES | CCC(CC)c1nc(CCOc2ccccc2)c(C)o1 |
| InChI | InChI=1S/C17H23NO2/c1-4-14(5-2)17-18-16(13(3)20-17)11-12-19-15-9-7-6-8-10-15/h6-10,14H,4-5,11-12H2,1-3H3 |
| InChIKey | BUOYWIFGHXCJJY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |