C10H6F2N4 — CID 82222595
2-[5-(3,4-difluorophenyl)triazol-1-yl]acetonitrile (PubChem CID 82222595) has the molecular formula C10H6F2N4 and a molecular weight of 220.18 g/mol. Its IUPAC name is 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetonitrile.
| Compound Name | 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 82222595 |
| Molecular Formula | C10H6F2N4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetonitrile |
| SMILES | N#CCn1nncc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H6F2N4/c11-8-2-1-7(5-9(8)12)10-6-14-15-16(10)4-3-13/h1-2,5-6H,4H2 |
| InChIKey | VHQYVUHYDOJMJY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |