C11H12F2N4 — CID 82222589
3-[5-(3,4-difluorophenyl)triazol-1-yl]propan-1-amine (PubChem CID 82222589) has the molecular formula C11H12F2N4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-[5-(3,4-difluorophenyl)triazol-1-yl]propan-1-amine.
| Compound Name | 3-[5-(3,4-difluorophenyl)triazol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 82222589 |
| Molecular Formula | C11H12F2N4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-[5-(3,4-difluorophenyl)triazol-1-yl]propan-1-amine |
| SMILES | NCCCn1nncc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H12F2N4/c12-9-3-2-8(6-10(9)13)11-7-15-16-17(11)5-1-4-14/h2-3,6-7H,1,4-5,14H2 |
| InChIKey | MEHNCRCYNJHLHM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |