C17H26ClN3O — CID 82224757
N-(4-amino-2-chlorophenyl)-3-methyl-2-(4-methylpiperidin-1-yl)butanamide (PubChem CID 82224757) has the molecular formula C17H26ClN3O and a molecular weight of 323.87 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-3-methyl-2-(4-methylpiperidin-1-yl)butanamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-3-methyl-2-(4-methylpiperidin-1-yl)butanamide |
|---|---|
| PubChem CID | 82224757 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-3-methyl-2-(4-methylpiperidin-1-yl)butanamide |
| SMILES | CC1CCN(C(C(=O)Nc2ccc(N)cc2Cl)C(C)C)CC1 |
| InChI | InChI=1S/C17H26ClN3O/c1-11(2)16(21-8-6-12(3)7-9-21)17(22)20-15-5-4-13(19)10-14(15)18/h4-5,10-12,16H,6-9,19H2,1-3H3,(H,20,22) |
| InChIKey | SQKPOVKXZPHAKR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|