C15H24N2O2S — CID 82227287
2-(azepan-1-ylmethyl)-4-butyl-1,3-thiazole-5-carboxylic acid (PubChem CID 82227287) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-(azepan-1-ylmethyl)-4-butyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(azepan-1-ylmethyl)-4-butyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82227287 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-(azepan-1-ylmethyl)-4-butyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCCc1nc(CN2CCCCCC2)sc1C(=O)O |
| InChI | InChI=1S/C15H24N2O2S/c1-2-3-8-12-14(15(18)19)20-13(16-12)11-17-9-6-4-5-7-10-17/h2-11H2,1H3,(H,18,19) |
| InChIKey | KRWLOXSBTQRRBD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |