About 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid
2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 82227711) has the molecular formula C14H22N2O3S
and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid |
| PubChem CID | 82227711 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid |
| SMILES | Cc1nc(CCN2CC(C)OC(C)C2)sc1CC(=O)O |
| InChI | InChI=1S/C14H22N2O3S/c1-9-7-16(8-10(2)19-9)5-4-13-15-11(3)12(20-13)6-14(17)18/h9-10H,4-8H2,1-3H3,(H,17,18) |
| InChIKey | OHOZZPZPKBBLMS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid?
The IUPAC name of 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid (CID 82227711) is 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid?
The canonical SMILES for 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid is Cc1nc(CCN2CC(C)OC(C)C2)sc1CC(=O)O.
What is the InChIKey of 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid?
The InChIKey is OHOZZPZPKBBLMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3S/c1-9-7-16(8-10(2)19-9)5-4-13-15-11(3)12(20-13)6-14(17)18/h9-10H,4-8H2,1-3H3,(H,17,18).
What are the key properties of 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid?
2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid has a molecular weight of 298.41 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4-methyl-1,3-thiazol-5-yl]acetic acid is sourced from PubChem (CID 82227711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).