About 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid
2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid (PubChem CID 82054967) has the molecular formula C11H17NO2S
and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid |
| PubChem CID | 82054967 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid |
| SMILES | CCCCCc1nc(C)c(CC(=O)O)s1 |
| InChI | InChI=1S/C11H17NO2S/c1-3-4-5-6-10-12-8(2)9(15-10)7-11(13)14/h3-7H2,1-2H3,(H,13,14) |
| InChIKey | MWIFCSYGWPCOEI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid?
The IUPAC name of 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid (CID 82054967) is 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid.
What is the SMILES notation for 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid?
The canonical SMILES for 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid is CCCCCc1nc(C)c(CC(=O)O)s1.
What is the InChIKey of 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid?
The InChIKey is MWIFCSYGWPCOEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S/c1-3-4-5-6-10-12-8(2)9(15-10)7-11(13)14/h3-7H2,1-2H3,(H,13,14).
What are the key properties of 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid?
2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid has a molecular weight of 227.33 g/mol, XLogP of 2.81, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-2-pentyl-1,3-thiazol-5-yl)acetic acid is sourced from PubChem (CID 82054967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).