C15H25NO2S — CID 70616107
2-(4,5-dipentyl-1,3-thiazol-2-yl)acetic acid (PubChem CID 70616107) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is 2-(4,5-dipentyl-1,3-thiazol-2-yl)acetic acid.
| Compound Name | 2-(4,5-dipentyl-1,3-thiazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 70616107 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-(4,5-dipentyl-1,3-thiazol-2-yl)acetic acid |
| SMILES | CCCCCc1nc(CC(=O)O)sc1CCCCC |
| InChI | InChI=1S/C15H25NO2S/c1-3-5-7-9-12-13(10-8-6-4-2)19-14(16-12)11-15(17)18/h3-11H2,1-2H3,(H,17,18) |
| InChIKey | LMIRMMWSQZONGX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|