About 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone
1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone (PubChem CID 82234671) has the molecular formula C10H17N5O
and a molecular weight of 223.28 g/mol. Its IUPAC name is 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone |
| PubChem CID | 82234671 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(c2cn[nH]c2N)CC1 |
| InChI | InChI=1S/C10H17N5O/c1-8(16)14-3-2-4-15(6-5-14)9-7-12-13-10(9)11/h7H,2-6H2,1H3,(H3,11,12,13) |
| InChIKey | GUPIZONYWYVZBN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone?
The IUPAC name of 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone (CID 82234671) is 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone.
What is the SMILES notation for 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone?
The canonical SMILES for 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone is CC(=O)N1CCCN(c2cn[nH]c2N)CC1.
What is the InChIKey of 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone?
The InChIKey is GUPIZONYWYVZBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O/c1-8(16)14-3-2-4-15(6-5-14)9-7-12-13-10(9)11/h7H,2-6H2,1H3,(H3,11,12,13).
What are the key properties of 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone?
1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone has a molecular weight of 223.28 g/mol, XLogP of 0.05, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(5-amino-1H-pyrazol-4-yl)-1,4-diazepan-1-yl]ethanone is sourced from PubChem (CID 82234671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).