C4H7N3O2 — CID 82234828
2-amino-2-(1,2,4-oxadiazol-5-yl)ethanol (PubChem CID 82234828) has the molecular formula C4H7N3O2 and a molecular weight of 129.12 g/mol. Its IUPAC name is 2-amino-2-(1,2,4-oxadiazol-5-yl)ethanol.
| Compound Name | 2-amino-2-(1,2,4-oxadiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 82234828 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | 2-amino-2-(1,2,4-oxadiazol-5-yl)ethanol |
| SMILES | NC(CO)c1ncno1 |
| InChI | InChI=1S/C4H7N3O2/c5-3(1-8)4-6-2-7-9-4/h2-3,8H,1,5H2 |
| InChIKey | MIDABTHQVGXTNN-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |