C8H8ClN3S — CID 82236048
(5-chlorothiophen-2-yl)-(1H-pyrazol-5-yl)methanamine (PubChem CID 82236048) has the molecular formula C8H8ClN3S and a molecular weight of 213.69 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-(1H-pyrazol-5-yl)methanamine.
| Compound Name | (5-chlorothiophen-2-yl)-(1H-pyrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 82236048 |
| Molecular Formula | C8H8ClN3S |
| Molecular Weight | 213.69 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | (5-chlorothiophen-2-yl)-(1H-pyrazol-5-yl)methanamine |
| SMILES | NC(c1ccn[nH]1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H8ClN3S/c9-7-2-1-6(13-7)8(10)5-3-4-11-12-5/h1-4,8H,10H2,(H,11,12) |
| InChIKey | HAADLIJMTUQGMC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.69 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |