C10H15ClN2S — CID 95448503
(R)-(5-chlorothiophen-2-yl)-piperidin-4-ylmethanamine (PubChem CID 95448503) has the molecular formula C10H15ClN2S and a molecular weight of 230.76 g/mol. Its IUPAC name is (R)-(5-chlorothiophen-2-yl)-piperidin-4-ylmethanamine.
| Compound Name | (R)-(5-chlorothiophen-2-yl)-piperidin-4-ylmethanamine |
|---|---|
| PubChem CID | 95448503 |
| Molecular Formula | C10H15ClN2S |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (R)-(5-chlorothiophen-2-yl)-piperidin-4-ylmethanamine |
| SMILES | N[C@@H](c1ccc(Cl)s1)C1CCNCC1 |
| InChI | InChI=1S/C10H15ClN2S/c11-9-2-1-8(14-9)10(12)7-3-5-13-6-4-7/h1-2,7,10,13H,3-6,12H2/t10-/m1/s1 |
| InChIKey | CVRWKKXSPOYAQS-SNVBAGLBSA-N |
| XLogP | 2.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |