2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid

C11H19NO3 — CID 82236437

IUPAC2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid
SMILESCC1COCCN1C(C)(C(=O)O)C1CC1
InChIInChI=1S/C11H19NO3/c1-8-7-15-6-5-12(8)11(2,10(13)14)9-3-4-9/h8-9H,3-7H2,1-2H3,(H,13,14)
InChIKeyAYDNKDLMZCFZJK-UHFFFAOYSA-N
MW213.28 g/mol
LogP0.96
Rot. Bonds3

About 2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid

2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid (PubChem CID 82236437) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid.

Molecular Properties

Compound Name2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid
PubChem CID82236437
Molecular FormulaC11H19NO3
Molecular Weight213.28 g/mol
Exact Mass213.14
IUPAC Name2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid
SMILESCC1COCCN1C(C)(C(=O)O)C1CC1
InChIInChI=1S/C11H19NO3/c1-8-7-15-6-5-12(8)11(2,10(13)14)9-3-4-9/h8-9H,3-7H2,1-2H3,(H,13,14)
InChIKeyAYDNKDLMZCFZJK-UHFFFAOYSA-N
XLogP0.96
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.28
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,5-dimethyl-2-(3-methylmorpholin-4-yl)hexanoic acid
CID 114994046
(3R)-3-methyl-4-(2-methylbutan-2-yl)morpholine
CID 170219937
2,3-dimethyl-2-(3-methylmorpholin-4-yl)butan-1-amine
CID 61353365
2-hydroxy-2-methyl-1-(3-methylmorpholin-4-yl)propan-1-one
CID 103429510
2-cyclopropyl-2-(2,6-dimethylmorpholin-4-yl)propanoic acid
CID 114988393
(2R)-2-amino-3,3-dimethyl-1-(3-methylmorpholin-4-yl)butan-1-one
CID 103928483
2-[ethyl-(3-methylmorpholine-4-carbonyl)amino]-2-methylpropanoic acid
CID 62820763
2-amino-2-cyclopropyl-3-(3-methylmorpholin-4-yl)propanamide
CID 63911495
(2R,5S)-5-[(3R)-3-methylmorpholine-4-carbonyl]oxolane-2-carboxylic acid
CID 106773953
(3R)-N-tert-butyl-3-methylmorpholine-4-carboxamide
CID 106774167
2-cyclopropyl-2-(4,4-dimethylpiperidin-1-yl)propanoic acid
CID 82237816
2-cyclopropyl-2-(3,5-dioxo-1,2,4-triazolidin-4-yl)propanoic acid
CID 107409501

Frequently Asked Questions

What is the IUPAC name of 2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid?
The IUPAC name of 2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid (CID 82236437) is 2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid.
What is the SMILES notation for 2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid?
The canonical SMILES for 2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid is CC1COCCN1C(C)(C(=O)O)C1CC1.
What is the InChIKey of 2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid?
The InChIKey is AYDNKDLMZCFZJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-8-7-15-6-5-12(8)11(2,10(13)14)9-3-4-9/h8-9H,3-7H2,1-2H3,(H,13,14).
What are the key properties of 2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid?
2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid has a molecular weight of 213.28 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-(3-methylmorpholin-4-yl)propanoic acid is sourced from PubChem (CID 82236437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).