C10H13N5 — CID 82238157
4-N-(2-pyridin-3-ylethyl)-1H-pyrazole-4,5-diamine (PubChem CID 82238157) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 4-N-(2-pyridin-3-ylethyl)-1H-pyrazole-4,5-diamine.
| Compound Name | 4-N-(2-pyridin-3-ylethyl)-1H-pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 82238157 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 4-N-(2-pyridin-3-ylethyl)-1H-pyrazole-4,5-diamine |
| SMILES | Nc1[nH]ncc1NCCc1cccnc1 |
| InChI | InChI=1S/C10H13N5/c11-10-9(7-14-15-10)13-5-3-8-2-1-4-12-6-8/h1-2,4,6-7,13H,3,5H2,(H3,11,14,15) |
| InChIKey | MOVJBSHSVIWBFM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |