C12H18N2O — CID 82241461
1-ethyl-8-methoxy-2,3,4,5-tetrahydro-1,4-benzodiazepine (PubChem CID 82241461) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-ethyl-8-methoxy-2,3,4,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | 1-ethyl-8-methoxy-2,3,4,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 82241461 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-ethyl-8-methoxy-2,3,4,5-tetrahydro-1,4-benzodiazepine |
| SMILES | CCN1CCNCc2ccc(OC)cc21 |
| InChI | InChI=1S/C12H18N2O/c1-3-14-7-6-13-9-10-4-5-11(15-2)8-12(10)14/h4-5,8,13H,3,6-7,9H2,1-2H3 |
| InChIKey | JPICGGJEQYHTTC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |