About 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile
8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile (PubChem CID 82241492) has the molecular formula C11H10FNO2
and a molecular weight of 207.20 g/mol. Its IUPAC name is 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile.
Molecular Properties
| Compound Name | 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile |
| PubChem CID | 82241492 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile |
| SMILES | N#CC1(O)CCCOc2cc(F)ccc21 |
| InChI | InChI=1S/C11H10FNO2/c12-8-2-3-9-10(6-8)15-5-1-4-11(9,14)7-13/h2-3,6,14H,1,4-5H2 |
| InChIKey | CWZOMSTUTQSPGB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile?
The IUPAC name of 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile (CID 82241492) is 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile.
What is the SMILES notation for 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile?
The canonical SMILES for 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile is N#CC1(O)CCCOc2cc(F)ccc21.
What is the InChIKey of 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile?
The InChIKey is CWZOMSTUTQSPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO2/c12-8-2-3-9-10(6-8)15-5-1-4-11(9,14)7-13/h2-3,6,14H,1,4-5H2.
What are the key properties of 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile?
8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile has a molecular weight of 207.20 g/mol, XLogP of 1.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carbonitrile is sourced from PubChem (CID 82241492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).